Difference between revisions of "MANNOSE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00003966001_1 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-galdieria.sulphuraria * UBIQUITIN--PROTEIN-LI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == |
| + | * smiles: | ||
| + | ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L | ||
| + | * common name: | ||
| + | ** (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate | ||
| + | * molecular weight: | ||
| + | ** 170.121 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate | ||
| + | ** HHDD | ||
| + | ** (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN1K-87]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[CARBOXY-OXOHEPT-ENEDIOATE-DECARBOXY-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91828271 91828271] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.11531600.html 11531600] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87504 87504] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05600 C05600] | ||
| + | {{#set: smiles=C([O-])(=O)CC=CC=C(O)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L}} | ||
| + | {{#set: common name=(2Z,4Z)-2-hydroxyhepta-2,4-dienedioate}} | ||
| + | {{#set: molecular weight=170.121 }} | ||
| + | {{#set: common name=(2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate|HHDD|(2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate}} | ||
| + | {{#set: consumed by=RXN1K-87}} | ||
| + | {{#set: produced by=CARBOXY-OXOHEPT-ENEDIOATE-DECARBOXY-RXN}} | ||
Revision as of 11:26, 18 January 2018
Contents
Metabolite CPD-787
- smiles:
- C([O-])(=O)CC=CC=C(O)C(=O)[O-]
- inchi key:
- InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L
- common name:
- (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate
- molecular weight:
- 170.121
- Synonym(s):
- (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate
- HHDD
- (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CC=CC=C(O)C(=O)[O-" cannot be used as a page name in this wiki.
