Difference between revisions of "CHC T00000418001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** fatty acid α-oxidation III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''3''' reaction(s) found | |
− | * [[ | + | ** [[RXN66-477]] |
− | == Reaction(s) | + | ** [[RXN66-476]] |
− | * [ | + | ** [[RXN66-474]] |
− | * [[ | + | == Reaction(s) not found == |
+ | * '''4''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=CERAMIDASE-YEAST-RXN CERAMIDASE-YEAST-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-4042 RXN3O-4042] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-COA-HYDROLASE-RXN FORMYL-COA-HYDROLASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN66-475 RXN66-475] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: common name=fatty acid α-oxidation III}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=4}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 11:26, 18 January 2018
Pathway PWY66-388
- taxonomic range:
- common name:
- fatty acid α-oxidation III
- Synonym(s):
Reaction(s) found
Reaction(s) not found
- 4 reaction(s) not found