Difference between revisions of "ISOBUTYRYL-COA-MUTASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13297 RXN-13297] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13297 RXN-13297] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199]
+
** InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
 +
* common name:
 +
** 7,9,9'-cis-neurosporene
 +
* molecular weight:
 +
** 538.898   
 
* Synonym(s):
 
* Synonym(s):
 +
** proneurosporene
 +
** 7,9,9'-tri-cis-neurosporene
 +
** 7,9,9'-tricis-neurosporene
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-11357]]
−
** 1 [[MALONYL-COA]][c] '''+''' 1 [[CPD-10279]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-14273]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-11356]]
−
** 1 malonyl-CoA[c] '''+''' 1 docosanoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 3-oxo-lignoceroyl-CoA[c] '''+''' 1 CO2[c] '''+''' 1 coenzyme A[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
−
** '''8''' reactions found over '''16''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[gap-filling]]:
+
−
** [[meneco]]:
+
−
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.3.1.199}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C19759 C19759]
−
{{#set: in pathway=PWY-7036}}
+
* CHEBI:
−
{{#set: reconstruction category=gap-filling}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62463 62463]
−
{{#set: reconstruction tool=meneco}}
+
* PUBCHEM:
−
{{#set: reconstruction source=added for gapfilling}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244751 25244751]
 +
{{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}}
 +
{{#set: inchi key=InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N}}
 +
{{#set: common name=7,9,9'-cis-neurosporene}}
 +
{{#set: molecular weight=538.898    }}
 +
{{#set: common name=proneurosporene|7,9,9'-tri-cis-neurosporene|7,9,9'-tricis-neurosporene}}
 +
{{#set: consumed by=RXN-11357}}
 +
{{#set: produced by=RXN-11356}}

Revision as of 11:26, 18 January 2018

Metabolite CPD-7524

  • smiles:
    • CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
  • inchi key:
    • InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
  • common name:
    • 7,9,9'-cis-neurosporene
  • molecular weight:
    • 538.898
  • Synonym(s):
    • proneurosporene
    • 7,9,9'-tri-cis-neurosporene
    • 7,9,9'-tricis-neurosporene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=ISOBUTYRYL-COA-MUTASE-RXN&oldid=8129"