Difference between revisions of "L-SELENOCYSTEINE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008533001_1 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12124 CPD-12124] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12124 CPD-12124] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZVENTDGZQVBWNA-RCIYGOBDSA-N | ||
+ | * common name: | ||
+ | ** menaquinol-6 | ||
+ | * molecular weight: | ||
+ | ** 582.908 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** menaquinol(6) | ||
+ | ** MKH2-6 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-9220]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6441040 6441040] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4945264.html 4945264] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84536 84536] | ||
+ | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C}} | ||
+ | {{#set: inchi key=InChIKey=ZVENTDGZQVBWNA-RCIYGOBDSA-N}} | ||
+ | {{#set: common name=menaquinol-6}} | ||
+ | {{#set: molecular weight=582.908 }} | ||
+ | {{#set: common name=menaquinol(6)|MKH2-6}} | ||
+ | {{#set: produced by=RXN-9220}} |
Revision as of 11:27, 18 January 2018
Contents
Metabolite CPD-12124
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C
- inchi key:
- InChIKey=ZVENTDGZQVBWNA-RCIYGOBDSA-N
- common name:
- menaquinol-6
- molecular weight:
- 582.908
- Synonym(s):
- menaquinol(6)
- MKH2-6
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links