Difference between revisions of "RXN-7828"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * inchi key: ** InChIKey=JT...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** chitin degradation to ethanol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''4''' reaction(s) found | |
− | * [[ | + | ** [[ALCOHOL-DEHYDROG-RXN]] |
− | == Reaction(s) | + | ** [[1.1.1.39-RXN]] |
+ | ** [[ACETATE--COA-LIGASE-RXN]] | ||
+ | ** [[RXN-6161]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''2''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=MALSYN-RXN MALSYN-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=CHITIN-DEACETYLASE-RXN CHITIN-DEACETYLASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33154}} | |
− | + | {{#set: common name=chitin degradation to ethanol}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: reaction not found=2}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:27, 18 January 2018
Pathway PWY-7118
- taxonomic range:
- common name:
- chitin degradation to ethanol
- Synonym(s):
Reaction(s) found
- 4 reaction(s) found
Reaction(s) not found
- 2 reaction(s) not found