Difference between revisions of "PWY-7303"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE DEOXYCYTIDINE] == * smiles: ** C1(=CN(C(=O)N=C(N)1)C2(CC(O)C(CO)O2)) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7657 RXN-7657] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1.1...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7657 RXN-7657] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[ISOBUTANOL]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[CPD-7000]][c] '''+''' 1 [[PROTON]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 isobutanol[c] '''+''' 1 NAD+[c] '''<=>''' 1 NADH[c] '''+''' 1 isobutanal[c] '''+''' 1 H+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[CHC_T00010066001_1]] | ||
| + | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
| + | == Pathways == | ||
| + | * [[PWY-7396]], butanol and isobutanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396] | ||
| + | ** '''4''' reactions found over '''8''' reactions in the full pathway | ||
| + | * [[PWY-7111]], pyruvate fermentation to isobutanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7111 PWY-7111] | ||
| + | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
| + | * [[PWY-5057]], L-valine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5057 PWY-5057] | ||
| + | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: ec number=EC-1.1.1.1}} | |
| − | + | {{#set: gene associated=CHC_T00010066001_1}} | |
| − | + | {{#set: in pathway=PWY-7396|PWY-7111|PWY-5057}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=galdieria.sulphuraria}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 12:29, 18 January 2018
Contents
Reaction RXN-7657
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ISOBUTANOL[c] + 1 NAD[c] <=> 1 NADH[c] + 1 CPD-7000[c] + 1 PROTON[c]
- With common name(s):
- 1 isobutanol[c] + 1 NAD+[c] <=> 1 NADH[c] + 1 isobutanal[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-7396, butanol and isobutanol biosynthesis (engineered): PWY-7396
- 4 reactions found over 8 reactions in the full pathway
- PWY-7111, pyruvate fermentation to isobutanol (engineered): PWY-7111
- 5 reactions found over 5 reactions in the full pathway
- PWY-5057, L-valine degradation II: PWY-5057
- 3 reactions found over 3 reactions in the full pathway
