Difference between revisions of "INDOLE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2)) * common name: ** 6...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14189 RXN-14189] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14189 RXN-14189] ==
* smiles:
+
* direction:
** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))
+
** LEFT-TO-RIGHT
* common name:
+
* ec number:
** 6-carboxy-5,6,7,8-tetrahydropterin
+
** [http://enzyme.expasy.org/EC/1.11.1.6 EC-1.11.1.6]
* inchi key:
+
** InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M
+
* molecular weight:
+
** 210.172   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-carboxytetrahydropterin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN0-5507]]
+
** 1 [[METOH]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[FORMALDEHYDE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 methanol[c] '''+''' 1 hydrogen peroxide[c] '''=>''' 2 H2O[c] '''+''' 1 formaldehyde[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00007915001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
** [[pantograph]]-[[a.taliana]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 +
*** [[a.taliana]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123380 44123380]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00602 R00602]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61032 61032]
+
{{#set: ec number=EC-1.11.1.6}}
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))}}
+
{{#set: gene associated=CHC_T00007915001_1}}
{{#set: common name=6-carboxy-5,6,7,8-tetrahydropterin}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=210.172    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=6-carboxytetrahydropterin}}
+
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
{{#set: produced by=RXN0-5507}}
+

Revision as of 11:29, 18 January 2018

Reaction RXN-14189

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links