Difference between revisions of "DICHLOROMETHANE-DEHALOGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008320001 == * left end position: ** 89942 * transcription direction: ** POSITIVE * right end position: ** 92026 * centisome position: ** 34.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * smiles: ** CC(C)(CO)C(C([O-])=O)O * inchi key: ** InChIKey=OTOIIPJY...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene CHC_T00008320001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] ==
−
* left end position:
+
* smiles:
−
** 89942
+
** CC(C)(CO)C(C([O-])=O)O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
−
* right end position:
+
* common name:
−
** 92026
+
** (R)-pantoate
−
* centisome position:
+
* molecular weight:
−
** 34.704266    
+
** 147.15    
 
* Synonym(s):
 
* Synonym(s):
 +
** pantoate
 +
** L-pantoate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ACETATE--COA-LIGASE-RXN]]
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
−
** original_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY66-161]]
+
−
* [[PWY66-21]]
+
−
* [[PWY66-162]]
+
−
* [[PWY0-1313]]
+
−
* [[PWY-6672]]
+
−
* [[PWY-7118]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=89942}}
+
* CAS : 470-29-1
−
{{#set: transcription direction=POSITIVE}}
+
* DRUGBANK : DB01930
−
{{#set: right end position=92026}}
+
* PUBCHEM:
−
{{#set: centisome position=34.704266   }}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289105 5289105]
−
{{#set: reaction associated=ACETATE--COA-LIGASE-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY66-161|PWY66-21|PWY66-162|PWY0-1313|PWY-6672|PWY-7118}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00522 C00522]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4451134.html 4451134]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15980 15980]
 +
* BIGG : pant__R
 +
{{#set: smiles=CC(C)(CO)C(C([O-])=O)O}}
 +
{{#set: inchi key=InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M}}
 +
{{#set: common name=(R)-pantoate}}
 +
{{#set: molecular weight=147.15   }}
 +
{{#set: common name=pantoate|L-pantoate}}
 +
{{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}}
 +
{{#set: produced by=2-DEHYDROPANTOATE-REDUCT-RXN}}

Revision as of 11:30, 18 January 2018

Metabolite L-PANTOATE

  • smiles:
    • CC(C)(CO)C(C([O-])=O)O
  • inchi key:
    • InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
  • common name:
    • (R)-pantoate
  • molecular weight:
    • 147.15
  • Synonym(s):
    • pantoate
    • L-pantoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(CO)C(C([O-])=O)O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=DICHLOROMETHANE-DEHALOGENASE-RXN&oldid=8392"