Difference between revisions of "CHC T00008003001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1534 PWY0-1534] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1534 PWY0-1534] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
+
 
* common name:
 
* common name:
−
** 5'-hydroxycotinine
+
** hydrogen sulfide biosynthesis I
−
* molecular weight:
+
−
** 192.217   
+
 
* Synonym(s):
 
* Synonym(s):
−
** allohydroxycotinine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''1''' reaction(s) found
−
* [[RXN66-163]]
+
** [[CYSTEINE-AMINOTRANSFERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6945 RXN0-6945]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1534 PWY0-1534]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
+
{{#set: common name=hydrogen sulfide biosynthesis I}}
−
* HMDB : HMDB01427
+
{{#set: reaction found=1}}
−
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
+
{{#set: reaction not found=1}}
−
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
+
−
{{#set: common name=5'-hydroxycotinine}}
+
−
{{#set: molecular weight=192.217    }}
+
−
{{#set: common name=allohydroxycotinine}}
+
−
{{#set: produced by=RXN66-163}}
+

Revision as of 11:30, 18 January 2018

Pathway PWY0-1534

  • taxonomic range:
  • common name:
    • hydrogen sulfide biosynthesis I
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008003001_1&oldid=8448"