Difference between revisions of "PWY66-388"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17797 RXN-17797] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17797 RXN-17797] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
+
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
 +
* common name:
 +
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
 +
* molecular weight:
 +
** 414.713   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13711]]
−
** 1 [[WATER]][c] '''+''' 1 [[CPD-19150]][c] '''=>''' 1 [[CPD-19151]][c]
+
* [[RXN66-15]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 H2O[c] '''+''' 1 (2E,5Z)-dodecenoyl-CoA[c] '''=>''' 1 (S)-3-hydroxy-(5Z)-dodecenoyl-CoA[c]
+
* [[RXN66-14]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008557001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00009422001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00009349001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.1.1.35}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223]
−
{{#set: gene associated=CHC_T00008557001_1|CHC_T00009422001_1|CHC_T00009349001_1}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* HMDB : HMDB06840
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
 +
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}}
 +
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}}
 +
{{#set: molecular weight=414.713    }}
 +
{{#set: consumed by=RXN-13711|RXN66-15}}
 +
{{#set: produced by=RXN66-14}}

Revision as of 12:30, 18 January 2018

Metabolite CPD-8610

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
  • common name:
    • 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
  • molecular weight:
    • 414.713
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY66-388&oldid=8453"