Difference between revisions of "4.3.1.17-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2382 RXN0-2382] == * direction: ** LEFT-TO-RIGHT * common name: ** tryptophan synthase alpha c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2382 RXN0-2382] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** tryptophan synthase alpha chain |
− | * | + | ** Tryptophan synthase subunit beta |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/4.2.1.122 EC-4.2.1.122] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[SER]][c] '''+''' 1 [[INDOLE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[TRP]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 L-serine[c] '''+''' 1 indole[c] '''=>''' 1 H2O[c] '''+''' 1 L-tryptophan[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00009102001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[CHC_1120]] | ||
+ | ** ORIGINAL_GENOME | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | * [[CHC_T00008401001]] | ||
+ | ** ORIGINAL_GENOME | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[TRPSYN-PWY]], L-tryptophan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[original_genome]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26434 26434] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00674 R00674] | |
− | ** [http:// | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=tryptophan synthase alpha chain}} | |
− | * LIGAND- | + | {{#set: common name=Tryptophan synthase subunit beta}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-4.2.1.122}} |
− | + | {{#set: gene associated=CHC_T00009102001_1|CHC_1120|CHC_T00008401001}} | |
− | + | {{#set: in pathway=TRPSYN-PWY}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=galdieria.sulphuraria}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | {{#set: reconstruction source=original_genome}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:30, 18 January 2018
Contents
Reaction RXN0-2382
- direction:
- LEFT-TO-RIGHT
- common name:
- tryptophan synthase alpha chain
- Tryptophan synthase subunit beta
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 L-serine[c] + 1 indole[c] => 1 H2O[c] + 1 L-tryptophan[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- CHC_T00009102001_1
- CHC_1120
- ORIGINAL_GENOME
- AUTOMATED-NAME-MATCH
- ORIGINAL_GENOME
- CHC_T00008401001
- ORIGINAL_GENOME
- AUTOMATED-NAME-MATCH
- ORIGINAL_GENOME
Pathways
- TRPSYN-PWY, L-tryptophan biosynthesis: TRPSYN-PWY
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
External links