Difference between revisions of "RXN0-5234"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * smiles: ** CCCCCCCCC=CCCCCCCCC([O-])=O * inchi key: ** InChIKey=ZQP...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12203 RXN-12203] == * direction: ** LEFT-TO-RIGHT * common name: ** Alpha-glucan water dikinase...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12203 RXN-12203] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCCCCCC([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ZQPPMHVWECSIRJ-KTKRTIGZSA-M
+
 
* common name:
 
* common name:
** oleate
+
** Alpha-glucan water dikinase
* molecular weight:
+
* ec number:
** 281.457   
+
** [http://enzyme.expasy.org/EC/2.7.9.4 EC-2.7.9.4]
 
* Synonym(s):
 
* Synonym(s):
** oleic acid
 
** (9Z)-octadec-9-enoate
 
** (9Z)-octadecenoate
 
** (9Z)-octadecenoic acid
 
** (9Z)-octadec-9-enoic acid
 
** (Z)-octadec-9-enoic acid
 
** 18:1 n-9
 
** 18:1Δ9cis
 
** C18:1 n-9
 
** cis-9-octadecenoic acid
 
** cis-Δ9-octadecenoic acid
 
** cis-oleic acid
 
** octadec-9-enoic acid
 
** octadecenoate (n-C18:1)
 
** 9-octadecenoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9644]]
+
* With identifiers:
* [[RXN0-7239]]
+
** n [[ATP]][c] '''+''' n [[WATER]][c] '''+''' 1 [[Starch]][c] '''=>''' n [[AMP]][c] '''+''' n [[Pi]][c] '''+''' 1 [[6-Phosphogluco-Amylopectins]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
* [[3.1.2.14-RXN]]
+
** n ATP[c] '''+''' n H2O[c] '''+''' 1 starch[c] '''=>''' n AMP[c] '''+''' n phosphate[c] '''+''' 1 a 6-phosphogluco-amylopectin[c]
* [[RXN-15068]]
+
 
* [[RXN-15088]]
+
== Genes associated with this reaction  ==
* [[RXN-15067]]
+
Genes have been associated with this reaction based on different elements listed below.
* [[RXN-15035]]
+
* [[CHC_T00008789001]]
* [[RXN-15089]]
+
** ORIGINAL_GENOME
== Reaction(s) of unknown directionality ==
+
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6724]], starch degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6724 PWY-6724]
 +
** '''6''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
* CAS : 112-80-1
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC30823
+
{{#set: common name=Alpha-glucan water dikinase}}
* PUBCHEM:
+
{{#set: ec number=EC-2.7.9.4}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460221 5460221]
+
{{#set: gene associated=CHC_T00008789001}}
* HMDB : HMDB00207
+
{{#set: in pathway=PWY-6724}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C00712 C00712]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEMSPIDER:
+
{{#set: reconstruction source=original_genome}}
** [http://www.chemspider.com/Chemical-Structure.4573837.html 4573837]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30823 30823]
+
* BIGG : ocdcea
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC([O-])=O}}
+
{{#set: inchi key=InChIKey=ZQPPMHVWECSIRJ-KTKRTIGZSA-M}}
+
{{#set: common name=oleate}}
+
{{#set: molecular weight=281.457    }}
+
{{#set: common name=oleic acid|(9Z)-octadec-9-enoate|(9Z)-octadecenoate|(9Z)-octadecenoic acid|(9Z)-octadec-9-enoic acid|(Z)-octadec-9-enoic acid|18:1 n-9|18:1Δ9cis|C18:1 n-9|cis-9-octadecenoic acid|cis-Δ9-octadecenoic acid|cis-oleic acid|octadec-9-enoic acid|octadecenoate (n-C18:1)|9-octadecenoic acid}}
+
{{#set: consumed by=RXN-9644|RXN0-7239}}
+
{{#set: produced by=3.1.2.14-RXN|RXN-15068|RXN-15088|RXN-15067|RXN-15035|RXN-15089}}
+

Revision as of 11:31, 18 January 2018

Reaction RXN-12203

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Alpha-glucan water dikinase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • n ATP[c] + n H2O[c] + 1 starch[c] => n AMP[c] + n phosphate[c] + 1 a 6-phosphogluco-amylopectin[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6724, starch degradation II: PWY-6724
    • 6 reactions found over 9 reactions in the full pathway

Reconstruction information

External links