Difference between revisions of "PWY0-1587"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7268 PWY-7268] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7268 PWY-7268] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** NAD/NADP-NADH/NADPH cytosolic interconversion (yeast) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''3''' reaction(s) found | |
− | * [[RXN- | + | ** [[ISOCITDEH-RXN]] |
− | == Reaction(s) | + | ** [[NAD-KIN-RXN]] |
+ | ** [[GLU6PDEHYDROG-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''2''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-3962 RXN0-3962] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=NADH-KINASE-RXN NADH-KINASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=2}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:32, 18 January 2018
Pathway PWY-7268
- taxonomic range:
- common name:
- NAD/NADP-NADH/NADPH cytosolic interconversion (yeast)
- Synonym(s):
Reaction(s) found
- 3 reaction(s) found
Reaction(s) not found
- 2 reaction(s) not found