Difference between revisions of "CHC T00009254001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12539 RXN-12539] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12539 RXN-12539] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J
+
* common name:
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA
+
* molecular weight:
+
** 1037.905   
+
 
* Synonym(s):
 
* Synonym(s):
** OPC8-trans-2-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10697]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-479]][c] '''+''' 1 [[CPD-12377]][c] '''=>''' 2 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-7671]][c] '''+''' 1 [[ETHYLENE-CMPD]][c]
* [[RXN-10696]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 4-(methylthio)-2-oxobutanoate[c] '''+''' 1 hydroxyl radical[c] '''=>''' 2 CO2[c] '''+''' 1 methanethiol[c] '''+''' 1 ethene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6854]], ethylene biosynthesis III (microbes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854]
 +
** '''5''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237209 44237209]
+
{{#set: in pathway=PWY-6854}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA}}
+
{{#set: reconstruction source=original_genome}}
{{#set: molecular weight=1037.905    }}
+
{{#set: common name=OPC8-trans-2-enoyl-CoA}}
+
{{#set: consumed by=RXN-10697}}
+
{{#set: produced by=RXN-10696}}
+

Revision as of 11:33, 18 January 2018

Reaction RXN-12539

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-6854, ethylene biosynthesis III (microbes): PWY-6854
    • 5 reactions found over 7 reactions in the full pathway

Reconstruction information

External links