Difference between revisions of "CHC T00008316001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KETOISOCAPROATE-RXN KETOISOCAPROATE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-methy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KETOISOCAPROATE-RXN KETOISOCAPROATE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 4-methyl-2-oxopentanoate dehydrogenase (lipoamide) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.4.4 EC-1.2.4.4] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[BCAA-dehydrogenase-lipoyl]][c] '''+''' 1 [[2K-4CH3-PENTANOATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[BCAA-dehydrogenase-3MB-DH-lipoyl]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 an [apo BCAA dehydrogenase E2 protein] N6-lipoyl-L-lysine[c] '''+''' 1 4-methyl-2-oxopentanoate[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 a [apo BCAA dehydrogenase E2 protein] N6-S-[3-methylbutanoyl]dihydrolipoyl-L-lysine[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | == | + | * [[CHC_T00008584001_1]] |
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[CHC_T00006349001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P21839 P21839] |
− | * | + | ** [http://www.uniprot.org/uniprot/P21953 P21953] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P37940 P37940] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PK54 Q9PK54] |
− | * | + | ** [http://www.uniprot.org/uniprot/P37941 P37941] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P11178 P11178] |
− | * | + | ** [http://www.uniprot.org/uniprot/P12694 P12694] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P09061 P09061] |
− | * | + | ** [http://www.uniprot.org/uniprot/P09060 P09060] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P11960 P11960] |
− | * | + | ** [http://www.uniprot.org/uniprot/O84344 O84344] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9Z9E8 Q9Z9E8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9I1M2 Q9I1M2] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P35738 P35738] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P50136 P50136] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O48615 O48615] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O03849 O03849] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q53592 Q53592] |
+ | ** [http://www.uniprot.org/uniprot/Q53593 Q53593] | ||
+ | ** [http://www.uniprot.org/uniprot/O82450 O82450] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=4-methyl-2-oxopentanoate dehydrogenase (lipoamide)}} | ||
+ | {{#set: ec number=EC-1.2.4.4}} | ||
+ | {{#set: gene associated=CHC_T00008584001_1|CHC_T00006349001_1}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction tool=pantograph}} | ||
+ | {{#set: reconstruction source=galdieria.sulphuraria}} |
Revision as of 11:33, 18 January 2018
Contents
Reaction KETOISOCAPROATE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 4-methyl-2-oxopentanoate dehydrogenase (lipoamide)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 BCAA-dehydrogenase-lipoyl[c] + 1 2K-4CH3-PENTANOATE[c] + 1 PROTON[c] => 1 CARBON-DIOXIDE[c] + 1 BCAA-dehydrogenase-3MB-DH-lipoyl[c]
- With common name(s):
- 1 an [apo BCAA dehydrogenase E2 protein] N6-lipoyl-L-lysine[c] + 1 4-methyl-2-oxopentanoate[c] + 1 H+[c] => 1 CO2[c] + 1 a [apo BCAA dehydrogenase E2 protein] N6-S-[3-methylbutanoyl]dihydrolipoyl-L-lysine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
- UNIPROT: