Difference between revisions of "R-2-HYDROXYSTEARATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8036 RXN-8036] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8036 RXN-8036] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1.21 EC-3.2.1.21] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-7417]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[CPD-7418]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 cis-coumarinic acid-β-D-glucoside[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 coumarinate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00009266001_1]] | ||
+ | ** [[pantograph]]-[[a.taliana]] | ||
+ | * [[CHC_T00009011001_1]] | ||
+ | ** [[pantograph]]-[[a.taliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5176]], coumarin biosynthesis (via 2-coumarate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5176 PWY-5176] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[a.taliana]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31223 31223] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04998 R04998] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.2.1.21}} | |
− | * LIGAND- | + | {{#set: gene associated=CHC_T00009266001_1|CHC_T00009011001_1}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-5176}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=a.taliana}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:33, 18 January 2018
Contents
Reaction RXN-8036
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-7417[c] => 1 Glucopyranose[c] + 1 CPD-7418[c]
- With common name(s):
- 1 H2O[c] + 1 cis-coumarinic acid-β-D-glucoside[c] => 1 D-glucopyranose[c] + 1 coumarinate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-5176, coumarin biosynthesis (via 2-coumarate): PWY-5176
- 1 reactions found over 5 reactions in the full pathway
Reconstruction information
External links