Difference between revisions of "CPD-18346"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == * smiles: ** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O) *...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17155 RXN-17155] == * direction: ** LEFT-TO-RIGHT * common name: ** Acyl carrier protein ** acy...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17155 RXN-17155] ==
−
* smiles:
+
* direction:
−
** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZMJGSOSNSPKHNH-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** pyridoxamine 5'-phosphate
+
** Acyl carrier protein
−
* molecular weight:
+
** acyl carrier protein
−
** 247.167   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
 
* Synonym(s):
 
* Synonym(s):
−
** pyridoxamine phosphate
 
−
** PMP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PMPOXI-RXN]]
+
* With identifiers:
−
* [[RXN-14046]]
+
** 1 [[ACP]][c] '''+''' 1 [[CPD-18550]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[QXC-ACP]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[PYRAMKIN-RXN]]
+
** 1 a holo-[acyl-carrier protein][c] '''+''' 1 quinoxaline-2-carboxyl adenylate[c] '''=>''' 1 AMP[c] '''+''' 1 H+[c] '''+''' 1 quinoxaline-2-carboxyl-[acyl-carrier protein][c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[RXN0-5240]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00009135001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[CHC_655]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7735]], echinomycin and triostin A biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7735 PWY-7735]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* CAS : 529-96-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC58451
+
{{#set: common name=Acyl carrier protein}}
−
* PUBCHEM:
+
{{#set: common name=acyl carrier protein}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246271 25246271]
+
{{#set: ec number=EC-2.3.1}}
−
* HMDB : HMDB01555
+
{{#set: gene associated=CHC_T00009135001|CHC_655}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7735}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00647 C00647]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58451 58451]
+
{{#set: reconstruction source=original_genome}}
−
* BIGG : pyam5p
+
−
{{#set: smiles=CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O)}}
+
−
{{#set: inchi key=InChIKey=ZMJGSOSNSPKHNH-UHFFFAOYSA-M}}
+
−
{{#set: common name=pyridoxamine 5'-phosphate}}
+
−
{{#set: molecular weight=247.167    }}
+
−
{{#set: common name=pyridoxamine phosphate|PMP}}
+
−
{{#set: consumed by=PMPOXI-RXN|RXN-14046}}
+
−
{{#set: produced by=PYRAMKIN-RXN}}
+
−
{{#set: consumed or produced by=RXN0-5240}}
+

Revision as of 11:33, 18 January 2018

Reaction RXN-17155

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Acyl carrier protein
    • acyl carrier protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a holo-[acyl-carrier protein][c] + 1 quinoxaline-2-carboxyl adenylate[c] => 1 AMP[c] + 1 H+[c] + 1 quinoxaline-2-carboxyl-[acyl-carrier protein][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7735, echinomycin and triostin A biosynthesis: PWY-7735
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-18346&oldid=8670"