Difference between revisions of "3.1.1.64-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))O * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene CHC_T00009392001_1 == * Synonym(s): == Reactions associated == * 2.7.10.1-RXN ** pantograph-galdieria.sulphuraria * 2.7.12.1-RXN **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009392001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[2.7.10.1-RXN]] |
− | + | ** [[pantograph]]-[[galdieria.sulphuraria]] | |
− | * [[RXN- | + | * [[2.7.12.1-RXN]] |
− | == | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
+ | * [[RXN-14906]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.7.10.1-RXN|2.7.12.1-RXN|RXN-14906}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 12:33, 18 January 2018
Gene CHC_T00009392001_1
- Synonym(s):