Difference between revisions of "PWY-6118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_T00010074001 == * left end position: ** 103127 * transcription direction: ** NEGATIVE * right end position: ** 104344 * centisome position: ** 95...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00010074001 == |
− | * | + | * left end position: |
− | ** | + | ** 103127 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 104344 |
− | * | + | * centisome position: |
− | ** | + | ** 95.85274 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[ORNDECARBOX-RXN]] | |
− | * [[ | + | ** original_genome |
− | == | + | ***automated-name-match |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[ORNDEG-PWY]] |
+ | * [[PWY-6305]] | ||
+ | * [[PWY-46]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=103127}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=104344}} | |
− | + | {{#set: centisome position=95.85274 }} | |
− | + | {{#set: reaction associated=ORNDECARBOX-RXN}} | |
− | + | {{#set: pathway associated=ORNDEG-PWY|PWY-6305|PWY-46}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:34, 18 January 2018
Gene CHC_T00010074001
- left end position:
- 103127
- transcription direction:
- NEGATIVE
- right end position:
- 104344
- centisome position:
- 95.85274
- Synonym(s):
Reactions associated
- ORNDECARBOX-RXN
- original_genome
- automated-name-match
- original_genome