Difference between revisions of "RXN-17155"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006912001_1 == * Synonym(s): == Reactions associated == * RXN-11109 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == |
+ | * smiles: | ||
+ | ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** 4-hydroxy-2-nonenal-glutathione conjugate | ||
+ | * molecular weight: | ||
+ | ** 462.537 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13673]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725] | ||
+ | {{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}} | ||
+ | {{#set: molecular weight=462.537 }} | ||
+ | {{#set: produced by=RXN-13673}} |
Revision as of 11:34, 18 January 2018
Contents
Metabolite CPD-14704
- smiles:
- CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
- inchi key:
- InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
- common name:
- 4-hydroxy-2-nonenal-glutathione conjugate
- molecular weight:
- 462.537
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.