Difference between revisions of "CHC T00006316001 1"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008863001_1 == * Synonym(s): == Reactions associated == * PHEAMINOTRANS-RXN ** pantograph-a.taliana * TYROSINE-AMINOTRANSFERASE...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == |
+ | * smiles: | ||
+ | ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N | ||
+ | * common name: | ||
+ | ** cotinine | ||
+ | * molecular weight: | ||
+ | ** 176.218 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN66-169]] |
− | + | * [[RXN66-161]] | |
− | * [[ | + | * [[RXN66-163]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=854019 854019] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.746405.html 746405] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68641 68641] | ||
+ | * METABOLIGHTS : MTBLC68641 | ||
+ | * HMDB : HMDB01046 | ||
+ | {{#set: smiles=C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))}} | ||
+ | {{#set: inchi key=InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N}} | ||
+ | {{#set: common name=cotinine}} | ||
+ | {{#set: molecular weight=176.218 }} | ||
+ | {{#set: consumed by=RXN66-169|RXN66-161|RXN66-163}} |
Revision as of 12:34, 18 January 2018
Contents
Metabolite CPD-2742
- smiles:
- C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))
- inchi key:
- InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N
- common name:
- cotinine
- molecular weight:
- 176.218
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.