Difference between revisions of "ADENPRIBOSYLTRAN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00007155001_1 == * Synonym(s): == Reactions associated == * DIMETHYLARGININASE-RXN ** pantograph-galdieria.sulphuraria == Pathways...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00007155001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
 +
* smiles:
 +
** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
 +
* inchi key:
 +
** InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
 +
* common name:
 +
** 2'-hydroxynicotine
 +
* molecular weight:
 +
** 179.241   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[DIMETHYLARGININASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[RXN66-146]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=DIMETHYLARGININASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245599 25245599]
 +
* HMDB : HMDB01329
 +
{{#set: smiles=C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))}}
 +
{{#set: inchi key=InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O}}
 +
{{#set: common name=2'-hydroxynicotine}}
 +
{{#set: molecular weight=179.241    }}
 +
{{#set: produced by=RXN66-146}}

Revision as of 11:35, 18 January 2018

Metabolite CPD-3187

  • smiles:
    • C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
  • inchi key:
    • InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
  • common name:
    • 2'-hydroxynicotine
  • molecular weight:
    • 179.241
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.