Difference between revisions of "RXN-7706"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * smiles: ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] * common name: ** (R)-meva...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] == * common name: ** a malonyl-[acp] methyl...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a malonyl-[acp] methyl ester |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a malonyl-[acyl-carrier protein] methyl ester |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11474]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a malonyl-[acp] methyl ester}} | |
− | + | {{#set: common name=a malonyl-[acyl-carrier protein] methyl ester}} | |
− | + | {{#set: consumed by=RXN-11474}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: consumed by=RXN- | + | |
− | + |
Revision as of 11:35, 18 January 2018
Contents
Metabolite Malonyl-acp-methyl-ester
- common name:
- a malonyl-[acp] methyl ester
- Synonym(s):
- a malonyl-[acyl-carrier protein] methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a malonyl-[acp] methyl ester" cannot be used as a page name in this wiki.
"a malonyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.