Difference between revisions of "CHC T00008362001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009194001 == * left end position: ** 10833 * transcription direction: ** POSITIVE * right end position: ** 12476 * centisome position: ** 17.6...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00009194001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
* left end position:
+
* smiles:
** 10833
+
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
* right end position:
+
* common name:
** 12476
+
** tetrahydrogeranylgeranyl diphosphate
* centisome position:
+
* molecular weight:
** 17.661156    
+
** 451.456    
 
* Synonym(s):
 
* Synonym(s):
 +
** tetrahydroGGPP
 +
** tetrahydrogeranylgeranyl pyrophosphate
 +
** tetrahydrogeranylgeranyl-PP
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
== Reaction(s) of unknown directionality ==
***automated-name-match
+
* [[RXN-7659]]
== Pathways associated ==
+
* [[RXN-7660]]
* [[PWY-7219]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=10833}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
{{#set: right end position=12476}}
+
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
{{#set: centisome position=17.661156   }}
+
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
{{#set: reaction associated=ATPSYN-RXN}}
+
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
{{#set: pathway associated=PWY-7219}}
+
{{#set: molecular weight=451.456   }}
 +
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
 +
{{#set: consumed or produced by=RXN-7659|RXN-7660}}

Revision as of 12:35, 18 January 2018

Metabolite CPD-7003

  • smiles:
    • CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • inchi key:
    • InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
  • common name:
    • tetrahydrogeranylgeranyl diphosphate
  • molecular weight:
    • 451.456
  • Synonym(s):
    • tetrahydroGGPP
    • tetrahydrogeranylgeranyl pyrophosphate
    • tetrahydrogeranylgeranyl-PP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.