Difference between revisions of "CHC T00008362001"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009194001 == * left end position: ** 10833 * transcription direction: ** POSITIVE * right end position: ** 12476 * centisome position: ** 17.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K |
| − | * | + | * common name: |
| − | ** | + | ** tetrahydrogeranylgeranyl diphosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 451.456 |
* Synonym(s): | * Synonym(s): | ||
| + | ** tetrahydroGGPP | ||
| + | ** tetrahydrogeranylgeranyl pyrophosphate | ||
| + | ** tetrahydrogeranylgeranyl-PP | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-7659]] | |
| − | + | * [[RXN-7660]] | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275] |
| − | {{#set: | + | {{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}} |
| − | {{#set: | + | {{#set: common name=tetrahydrogeranylgeranyl diphosphate}} |
| − | {{#set: | + | {{#set: molecular weight=451.456 }} |
| + | {{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}} | ||
| + | {{#set: consumed or produced by=RXN-7659|RXN-7660}} | ||
Revision as of 11:35, 18 January 2018
Contents
Metabolite CPD-7003
- smiles:
- CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- inchi key:
- InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
- common name:
- tetrahydrogeranylgeranyl diphosphate
- molecular weight:
- 451.456
- Synonym(s):
- tetrahydroGGPP
- tetrahydrogeranylgeranyl pyrophosphate
- tetrahydrogeranylgeranyl-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.
