Difference between revisions of "PWY-3961"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12720 RXN-12720] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12720 RXN-12720] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/2.7.7.4 EC-2.7.7.4] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 2 [[PROTON]][c] '''+''' 1 [[SELENATE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-13713]][c] |
| − | == | + | * With common name(s): |
| + | ** 2 H+[c] '''+''' 1 selenate[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 adenosine 5'-phosphoselenate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[CHC_T00008316001_1]] | ||
| + | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
| + | ** [[pantograph]]-[[a.taliana]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6932]], selenate reduction: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6932 PWY-6932] | ||
| + | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[galdieria.sulphuraria]] | ||
| + | *** [[a.taliana]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.7.7.4}} | |
| − | + | {{#set: gene associated=CHC_T00008316001_1}} | |
| − | + | {{#set: in pathway=PWY-6932}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=galdieria.sulphuraria|a.taliana}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 11:35, 18 January 2018
Contents
Reaction RXN-12720
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 2 H+[c] + 1 selenate[c] + 1 ATP[c] => 1 diphosphate[c] + 1 adenosine 5'-phosphoselenate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
