Difference between revisions of "ASTERINA-330"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_680 == * left end position: ** 95761 * transcription direction: ** POSITIVE * right end position: ** 95859 * common name: ** petM * centisome pos...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-B CHLOROPHYLL-B] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_680 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-B CHLOROPHYLL-B] ==
* left end position:
+
* smiles:
** 95761
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
* transcription direction:
+
** POSITIVE
+
* right end position:
+
** 95859
+
 
* common name:
 
* common name:
** petM
+
** chlorophyll b
* centisome position:
+
* molecular weight:
** 53.17515    
+
** 907.486    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
* [[RXN-7674]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-101]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=95761}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11593175 11593175]
{{#set: right end position=95859}}
+
* CHEBI:
{{#set: common name=petM}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27888 27888]
{{#set: centisome position=53.17515   }}
+
* LIGAND-CPD:
{{#set: reaction associated=PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05307 C05307]
{{#set: pathway associated=PWY-101}}
+
* HMDB : HMDB31146
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=chlorophyll b}}
 +
{{#set: molecular weight=907.486   }}
 +
{{#set: produced by=RXN-7674}}

Revision as of 11:35, 18 January 2018

Metabolite CHLOROPHYLL-B

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • chlorophyll b
  • molecular weight:
    • 907.486
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.