Browse wiki
| CPD-18779 |
| Common name | (S)-4-deoxygadusol + |
|---|---|
| Consumed by | RXN-17368 + |
| Inchi key | InChIKey=ZONRIYAALKITGT-QMMMGPOBSA-N + |
| Molecular weight | 188.18 + |
| Produced by | RXN-17896 + |
| Reversible reaction associated | RXN-17370 + |
| Smiles | COC1(=C(O)CC(CO)(O)CC(=O)1) + |
| Categories | Metabolite |
| Modification date "Modification date" is a predefined property that corresponds to the date of the last modification of a subject and is provided by Semantic MediaWiki.
|
17:20:29, 9 January 2019 + |
| hide properties that link here |
| No properties link to this page. |
