Browse wiki
| CPD-7419 |
| Common name | Β-zeacarotene + |
|---|---|
| Inchi key | InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N + |
| Molecular weight | 538.898 + |
| Reversible reaction associated | RXN-8038 + |
| Smiles | CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1) + |
| Categories | Metabolite |
| Modification date "Modification date" is a predefined property that corresponds to the date of the last modification of a subject and is provided by Semantic MediaWiki.
|
14:44:22, 9 January 2019 + |
| hide properties that link here |
| No properties link to this page. |
