Difference between revisions of "CPD-1107"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * smiles: ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) | ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) | ||
| + | * molecular weight: | ||
| + | ** 569.977 | ||
* inchi key: | * inchi key: | ||
** InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D | ** InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D | ||
* common name: | * common name: | ||
** D-myo-inositol 1,3,4,5,6-pentakisphosphate | ** D-myo-inositol 1,3,4,5,6-pentakisphosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** Ins(1,3,4,5,6)P5 | ** Ins(1,3,4,5,6)P5 | ||
| Line 16: | Line 16: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-4941]] | * [[RXN-4941]] | ||
| + | * [[RXN-7163]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27570 27570] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27570 27570] | ||
* METABOLIGHTS : MTBLC57733 | * METABOLIGHTS : MTBLC57733 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01284 C01284] | ||
* HMDB : HMDB03529 | * HMDB : HMDB03529 | ||
{{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | {{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | ||
| + | {{#set: molecular weight=569.977 }} | ||
{{#set: inchi key=InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D}} | {{#set: inchi key=InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D}} | ||
{{#set: common name=D-myo-inositol 1,3,4,5,6-pentakisphosphate}} | {{#set: common name=D-myo-inositol 1,3,4,5,6-pentakisphosphate}} | ||
| − | |||
{{#set: common name=Ins(1,3,4,5,6)P5|1D-myo-inositol 1,3,4,5,6-pentakisphosphate|inositol 1,3,4,5,6-pentakisphosphate|I(1,3,4,5,6)P5}} | {{#set: common name=Ins(1,3,4,5,6)P5|1D-myo-inositol 1,3,4,5,6-pentakisphosphate|inositol 1,3,4,5,6-pentakisphosphate|I(1,3,4,5,6)P5}} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-4941|RXN-7163}} |
Latest revision as of 19:19, 9 January 2019
Contents
Metabolite CPD-1107
- smiles:
- C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
- molecular weight:
- 569.977
- inchi key:
- InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D
- common name:
- D-myo-inositol 1,3,4,5,6-pentakisphosphate
- Synonym(s):
- Ins(1,3,4,5,6)P5
- 1D-myo-inositol 1,3,4,5,6-pentakisphosphate
- inositol 1,3,4,5,6-pentakisphosphate
- I(1,3,4,5,6)P5
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.
