Difference between revisions of "Ec-12 003860"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16426 RXN-16426] == * direction: ** REVERSIBLE * common name: ** Phosphoacetylglucosamine mutas...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16426 RXN-16426] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
 +
* inchi key:
 +
** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
 
* common name:
 
* common name:
−
** Phosphoacetylglucosamine mutase
+
** thyroxine sulfate
 +
* molecular weight:
 +
** 855.924   
 
* Synonym(s):
 
* Synonym(s):
 +
** T4 sulfate
 +
** thyroxine-4-sulfate
 +
** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Phosphoacetylglucosamine-Mutase]][c] '''+''' 1 [[N-ACETYL-D-GLUCOSAMINE-16-BIS-P]][c] '''<=>''' 1 [[N-ACETYL-D-GLUCOSAMINE-1-P]][c] '''+''' 1 [[Phosphoacetylglucosamine-Mutase-P]][c]
+
* [[RXN-10614]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a phosphoacetylglucosamine mutase[c] '''+''' 1 N-acetyl-D-glucosamine 1,6-bisphosphate[c] '''<=>''' 1 N-acetyl-&alpha;-D-glucosamine 1-phosphate[c] '''+''' 1 a phosphorylated phosphoacetylglucosamine mutase[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-10_005030]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=Phosphoacetylglucosamine mutase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726]
−
{{#set: gene associated=Ec-10_005030}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910]
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: common name=thyroxine sulfate}}
 +
{{#set: molecular weight=855.924    }}
 +
{{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}}
 +
{{#set: produced by=RXN-10614}}

Revision as of 20:54, 17 March 2018

Metabolite CPD-11407

  • smiles:
    • C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
  • inchi key:
    • InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
  • common name:
    • thyroxine sulfate
  • molecular weight:
    • 855.924
  • Synonym(s):
    • T4 sulfate
    • thyroxine-4-sulfate
    • L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_003860&oldid=10822"