Difference between revisions of "Ec-27 005710"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-27_005710 == * left end position: ** 5266799 * transcription direction: ** POSITIVE * right end position: ** 5282780 * centisome position: ** 81.6...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_005710 == |
− | * | + | * left end position: |
− | ** | + | ** 5266799 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5282780 |
− | * | + | * centisome position: |
− | ** | + | ** 81.656975 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0000_0141 |
+ | ** Esi0000_0141 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[1.1.1.34-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-922]] | ||
+ | * [[PWY-6174]] | ||
+ | * [[PWY-7391]] | ||
+ | * [[PWY-7524]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5266799}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5282780}} | |
− | + | {{#set: centisome position=81.656975 }} | |
− | {{#set: | + | {{#set: common name=Esi_0000_0141|Esi0000_0141}} |
− | {{#set: | + | {{#set: reaction associated=1.1.1.34-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-922|PWY-6174|PWY-7391|PWY-7524}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:39, 21 March 2018
Gene Ec-27_005710
- left end position:
- 5266799
- transcription direction:
- POSITIVE
- right end position:
- 5282780
- centisome position:
- 81.656975
- Synonym(s):
- Esi_0000_0141
- Esi0000_0141
Reactions associated
- Reaction: 1.1.1.34-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome