Difference between revisions of "Ec-27 005710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...")
(Created page with "Category:Gene == Gene Ec-27_005710 == * left end position: ** 5266799 * transcription direction: ** POSITIVE * right end position: ** 5282780 * centisome position: ** 81.6...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] ==
+
== Gene Ec-27_005710 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
+
** 5266799
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** β-D-fructofuranose 1-phosphate
+
** 5282780
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 81.656975    
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-fructofuranose-1-P
+
** Esi_0000_0141
 +
** Esi0000_0141
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8631]]
+
* Reaction: [[1.1.1.34-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-922]]
 +
* [[PWY-6174]]
 +
* [[PWY-7391]]
 +
* [[PWY-7524]]
 
== External links  ==
 
== External links  ==
−
* CAS : 15978-08-2
+
{{#set: left end position=5266799}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216]
+
{{#set: right end position=5282780}}
−
* BIGG : 40936
+
{{#set: centisome position=81.656975   }}
−
{{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}}
+
{{#set: common name=Esi_0000_0141|Esi0000_0141}}
−
{{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}}
+
{{#set: reaction associated=1.1.1.34-RXN}}
−
{{#set: common name=β-D-fructofuranose 1-phosphate}}
+
{{#set: pathway associated=PWY-922|PWY-6174|PWY-7391|PWY-7524}}
−
{{#set: molecular weight=258.121   }}
+
−
{{#set: common name=β-D-fructofuranose-1-P}}
+
−
{{#set: consumed by=RXN-8631}}
+

Latest revision as of 19:39, 21 March 2018

Gene Ec-27_005710

  • left end position:
    • 5266799
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5282780
  • centisome position:
    • 81.656975
  • Synonym(s):
    • Esi_0000_0141
    • Esi0000_0141

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005710&oldid=28486"