Difference between revisions of "Ec-03 000580"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] == * smiles: ** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Gene == Gene Ec-03_000580 == * left end position: ** 702481 * transcription direction: ** NEGATIVE * right end position: ** 711092 * centisome position: ** 10.759...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] ==
+
== Gene Ec-03_000580 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 702481
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (2E,5Z)-dodecenoyl-CoA
+
** 711092
−
* molecular weight:
+
* centisome position:
−
** 941.776    
+
** 10.759954    
 
* Synonym(s):
 
* Synonym(s):
−
** 12:2-Δ2,Δ5-CoA
+
** Esi_0027_0087
−
** 2-trans,5-cis-dodecenoyl-CoA
+
** Esi0027_0087
 +
** HMGR1 N-terminus
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17797]]
+
* Reaction: [[1.1.1.34-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17796]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-922]]
 +
* [[PWY-6174]]
 +
* [[PWY-7391]]
 +
* [[PWY-7524]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=702481}}
−
{{#set: inchi key=InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(2E,5Z)-dodecenoyl-CoA}}
+
{{#set: right end position=711092}}
−
{{#set: molecular weight=941.776   }}
+
{{#set: centisome position=10.759954   }}
−
{{#set: common name=12:2-Δ2,Δ5-CoA|2-trans,5-cis-dodecenoyl-CoA}}
+
{{#set: common name=Esi_0027_0087|Esi0027_0087|HMGR1 N-terminus}}
−
{{#set: consumed by=RXN-17797}}
+
{{#set: reaction associated=1.1.1.34-RXN}}
−
{{#set: produced by=RXN-17796}}
+
{{#set: pathway associated=PWY-922|PWY-6174|PWY-7391|PWY-7524}}

Latest revision as of 19:39, 21 March 2018

Gene Ec-03_000580

  • left end position:
    • 702481
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 711092
  • centisome position:
    • 10.759954
  • Synonym(s):
    • Esi_0027_0087
    • Esi0027_0087
    • HMGR1 N-terminus

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_000580&oldid=28521"