Difference between revisions of "PWY-7571"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7571 PWY-7571] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7571 PWY-7571] ==
* smiles:
+
* taxonomic range:
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L
+
 
* common name:
 
* common name:
** biliverdin-IX-α
+
** ferrichrome A biosynthesis
* molecular weight:
+
** 580.639   
+
 
* Synonym(s):
 
* Synonym(s):
** dehydrobilirubin
 
** uteroverdine
 
** biliverdine
 
** biliverdin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[1.3.7.4-RXN]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-19_002030]]
 +
*** [[Ec-21_004360]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[METHYLGLUTACONYL-COA-HYDRATASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11128 RXN-11128]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15950 RXN-15950]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15951 RXN-15951]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-4751}}
** [http://www.genome.jp/dbget-bin/www_bget?C00500 C00500]
+
{{#set: common name=ferrichrome A biosynthesis}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57991 57991]
+
{{#set: total reaction=5}}
* METABOLIGHTS : MTBLC57991
+
{{#set: completion rate=40.0}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245769 25245769]
+
* HMDB : HMDB01008
+
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: inchi key=InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L}}
+
{{#set: common name=biliverdin-IX-α}}
+
{{#set: molecular weight=580.639    }}
+
{{#set: common name=dehydrobilirubin|uteroverdine|biliverdine|biliverdin}}
+
{{#set: consumed by=1.3.7.4-RXN}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY-7571

  • taxonomic range:
  • common name:
    • ferrichrome A biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links