Difference between revisions of "PWY-7571"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7571 PWY-7571] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7571 PWY-7571] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ferrichrome A biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]] | |
| − | * [[ | + | ** 2 associated gene(s): |
| − | * [[RXN- | + | *** [[Ec-19_002030]] |
| − | == Reaction(s) | + | *** [[Ec-21_004360]] |
| − | * [[ | + | ** 2 reconstruction source(s) associated: |
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[METHYLGLUTACONYL-COA-HYDRATASE-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11128 RXN-11128] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15950 RXN-15950] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15951 RXN-15951] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=ferrichrome A biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=40.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:06, 21 March 2018
Pathway PWY-7571
- taxonomic range:
- common name:
- ferrichrome A biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- METHYLGLUTACONYL-COA-HYDRATASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
