Difference between revisions of "Charged-CYS-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == * smiles: ** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O...")
(Created page with "Category:Gene == Gene Ec-03_000570 == * left end position: ** 699613 * transcription direction: ** NEGATIVE * right end position: ** 700287 * centisome position: ** 10.716...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] ==
+
== Gene Ec-03_000570 ==
* smiles:
+
* left end position:
** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 699613
* inchi key:
+
* transcription direction:
** InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J
+
** NEGATIVE
* common name:
+
* right end position:
** trans-Δ2, cis-Δ4-decadienoyl-CoA
+
** 700287
* molecular weight:
+
* centisome position:
** 913.722    
+
** 10.716025    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0027_0088
 +
** Esi0027_0088
 +
** HMGR1 C-terminus
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[DIENOYLCOAREDUCT-RXN]]
+
* Reaction: [[1.1.1.34-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-922]]
 +
* [[PWY-6174]]
 +
* [[PWY-7391]]
 +
* [[PWY-7524]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=699613}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658212 90658212]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=700287}}
{{#set: inchi key=InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J}}
+
{{#set: centisome position=10.716025    }}
{{#set: common name=trans-Δ2, cis-Δ4-decadienoyl-CoA}}
+
{{#set: common name=Esi_0027_0088|Esi0027_0088|HMGR1 C-terminus}}
{{#set: molecular weight=913.722    }}
+
{{#set: reaction associated=1.1.1.34-RXN}}
{{#set: consumed by=DIENOYLCOAREDUCT-RXN}}
+
{{#set: pathway associated=PWY-922|PWY-6174|PWY-7391|PWY-7524}}

Revision as of 13:47, 21 March 2018

Gene Ec-03_000570

  • left end position:
    • 699613
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 700287
  • centisome position:
    • 10.716025
  • Synonym(s):
    • Esi_0027_0088
    • Esi0027_0088
    • HMGR1 C-terminus

Reactions associated

Pathways associated

External links