Difference between revisions of "3-HYDROXY-KYNURENINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == * smiles: ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLGLYCINE-DEHYDROGENASE-RXN DIMETHYLGLYCINE-DEHYDROGENASE-RXN] == * direction: ** LEFT-TO-RIG...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLGLYCINE-DEHYDROGENASE-RXN DIMETHYLGLYCINE-DEHYDROGENASE-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dimethylglycine_dehydrogenase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.5.8.4 EC-1.5.8.4] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[ETF-Oxidized]][c] '''+''' 1 [[DIMETHYL-GLYCINE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[FORMALDEHYDE]][c] '''+''' 1 [[SARCOSINE]][c] '''+''' 1 [[ETF-Reduced]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 dimethylglycine[c] '''+''' 1 H2O[c] '''+''' 1 H+[c] '''=>''' 1 formaldehyde[c] '''+''' 1 sarcosine[c] '''+''' 1 a reduced electron-transfer flavoprotein[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_2717]] | ||
| + | ** IN-SILICO_ANNOTATION | ||
| + | ***AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-3661]], glycine betaine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661] | ||
| + | ** '''4''' reactions found over '''7''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22496 22496] |
| − | * | + | * LIGAND-RXN: |
| − | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01565 R01565] |
| − | * | + | * UNIPROT: |
| − | + | ** [http://www.uniprot.org/uniprot/Q63342 Q63342] | |
| − | ** [http:// | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: common name=dimethylglycine_dehydrogenase}} | |
| − | {{#set: | + | {{#set: ec number=EC-1.5.8.4}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_2717}} |
| − | {{#set: | + | {{#set: in pathway=PWY-3661}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | {{#set: reconstruction source=in-silico_annotation}} |
Revision as of 17:27, 10 January 2018
Contents
Reaction DIMETHYLGLYCINE-DEHYDROGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- dimethylglycine_dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ETF-Oxidized[c] + 1 DIMETHYL-GLYCINE[c] + 1 WATER[c] + 1 PROTON[c] => 1 FORMALDEHYDE[c] + 1 SARCOSINE[c] + 1 ETF-Reduced[c]
- With common name(s):
- 1 an oxidized electron-transfer flavoprotein[c] + 1 dimethylglycine[c] + 1 H2O[c] + 1 H+[c] => 1 formaldehyde[c] + 1 sarcosine[c] + 1 a reduced electron-transfer flavoprotein[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_2717
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- IN-SILICO_ANNOTATION
Pathways
- PWY-3661, glycine betaine degradation I: PWY-3661
- 4 reactions found over 7 reactions in the full pathway
Reconstruction information
External links
