Difference between revisions of "Tiso gene 16604"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11630 == * left end position: ** 3410 * transcription direction: ** POSITIVE * right end position: ** 7153 * centisome position: ** 44.5053...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] ==
+
== Gene Tiso_gene_11630 ==
−
* smiles:
+
* left end position:
−
** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+
** 3410
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-(7'-methylthio)heptylmalate
+
** 7153
−
* molecular weight:
+
* centisome position:
−
** 276.347    
+
** 44.505352    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(7'-methylthio)heptylmalic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXNQT-4178]]
+
* [[OHMETHYLBILANESYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
−
* [[RXN-18200]]
+
* [[UROGENIIISYN-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-5189]]
 +
* [[PWY-5188]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3410}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237172 44237172]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: right end position=7153}}
−
{{#set: inchi key=InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L}}
+
{{#set: centisome position=44.505352   }}
−
{{#set: common name=3-(7'-methylthio)heptylmalate}}
+
{{#set: reaction associated=OHMETHYLBILANESYN-RXN|UROGENIIISYN-RXN}}
−
{{#set: molecular weight=276.347   }}
+
{{#set: pathway associated=PWY-5189|PWY-5188}}
−
{{#set: common name=3-(7'-methylthio)heptylmalic acid}}
+
−
{{#set: consumed by=RXNQT-4178}}
+
−
{{#set: consumed or produced by=RXN-18200}}
+

Revision as of 18:35, 10 January 2018

Gene Tiso_gene_11630

  • left end position:
    • 3410
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7153
  • centisome position:
    • 44.505352
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16604&oldid=18509"