Difference between revisions of "CPD-14877"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == * smiles: ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6364 PWY-6364] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6364 PWY-6364] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-myo-inositol (1,3,4)-trisphosphate biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''3''' reactions found over '''3''' reactions in the full pathway | |
| − | + | * [[2.7.1.127-RXN]] | |
| − | * [[RXN- | + | ** 3 associated gene(s): |
| + | *** [[Tiso_gene_8121]] | ||
| + | *** [[Tiso_gene_15143]] | ||
| + | *** [[Tiso_gene_15142]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[3.1.3.62-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-8730]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_6030]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=D-myo-inositol (1,3,4)-trisphosphate biosynthesis}} | |
| − | {{#set: | + | {{#set: reaction found=3}} |
| − | + | {{#set: total reaction=3}} | |
| − | {{#set: common name= | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 14:52, 21 March 2018
Pathway PWY-6364
- taxonomic range:
- common name:
- D-myo-inositol (1,3,4)-trisphosphate biosynthesis
- Synonym(s):
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- 2.7.1.127-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- 3.1.3.62-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-8730
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
