Difference between revisions of "RXN-9655"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16313 RXN-16313] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16313 RXN-16313] ==
* smiles:
+
* direction:
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
+
** [http://enzyme.expasy.org/EC/2.3.2.24 EC-2.3.2.24]
* common name:
+
** α,ω-9Z-octadecenedioate
+
* molecular weight:
+
** 310.433   
+
 
* Synonym(s):
 
* Synonym(s):
** α,ω-9Z-octadecenedioic acid
 
** 1,18-9Z-octadecenedioic acid
 
** octadecenedioate
 
** 18-carboxyl oleate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-16418]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[S-ubiquitinyl-E3-independent-E2-Cys]][c] '''+''' 1 [[Protein-L-lysine]][c] '''=>''' 1 [[E3-independent-Ubiquitin-E2-L-cysteine]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PROTEIN-N-UBIQUITYL-LYSINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an S-ubiquitinyl-[(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''+''' 1 a [protein]-L-lysine[c] '''=>''' 1 an [(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''+''' 1 H+[c] '''+''' 1 an N6-monoubiquitinyl-[protein]-L-lysine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
+
{{#set: ec number=EC-2.3.2.24}}
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
{{#set: in pathway=PWY-7511}}
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=α,ω-9Z-octadecenedioate}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: molecular weight=310.433    }}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
+
{{#set: consumed by=RXN-16418}}
+

Revision as of 15:30, 21 March 2018

Reaction RXN-16313

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7511, protein ubiquitylation: PWY-7511
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links