Difference between revisions of "CPD-13684"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14775 RXN-14775] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
| − | ** | + | ** cholest-5-en-3-one |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N |
| + | * molecular weight: | ||
| + | ** 384.644 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12693]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107] | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906] | |
| − | + | * METABOLIGHTS : MTBLC63906 | |
| − | + | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | |
| − | {{#set: | + | {{#set: common name=cholest-5-en-3-one}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=384.644 }} |
| − | {{#set: | + | {{#set: produced by=RXN-12693}} |
| − | {{#set: | + | |
Latest revision as of 20:33, 21 March 2018
Contents
Metabolite CPD-13684
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- cholest-5-en-3-one
- inchi key:
- InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
- molecular weight:
- 384.644
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
