Difference between revisions of "Tiso gene 19078"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...") |
(Created page with "Category:Gene == Gene Tiso_gene_19078 == * right end position: ** 2181 * transcription direction: ** POSITIVE * left end position: ** 49 * centisome position: ** 1.8838909...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19078 == |
− | * | + | * right end position: |
− | ** | + | ** 2181 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 49 |
− | * | + | * centisome position: |
− | ** | + | ** 1.8838909 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-2601]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2181}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=49}} | |
− | + | {{#set: centisome position=1.8838909 }} | |
− | {{#set: | + | {{#set: reaction associated=RXN0-2601}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:11, 21 March 2018
Gene Tiso_gene_19078
- right end position:
- 2181
- transcription direction:
- POSITIVE
- left end position:
- 49
- centisome position:
- 1.8838909
- Synonym(s):
Reactions associated
- Reaction: RXN0-2601
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation