Difference between revisions of "Tiso gene 11016"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=...")
(Created page with "Category:Gene == Gene Tiso_gene_11016 == * right end position: ** 5075 * transcription direction: ** POSITIVE * left end position: ** 2656 * centisome position: ** 32.6892...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] ==
+
== Gene Tiso_gene_11016 ==
−
* smiles:
+
* right end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5075
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-oxoadipyl-CoA
+
** 2656
−
* molecular weight:
+
* centisome position:
−
** 904.605    
+
** 32.68923    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-ketoadipyl-CoA
 
−
** 3-keto-adipyl-coa
 
−
** β-ketoadipyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.1.1.145-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN0-2044]]
+
*** Assignment: ec-number
 +
* Reaction: [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[PEROXID-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-1101]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN-1106]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN-1124]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN-12693]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12747]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12789]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14240]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-600]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN-7784]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9725]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN66-342]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-350]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-353]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7299]]
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-5152]]
 +
* [[PWY-5461]]
 +
* [[PWY66-378]]
 +
* [[PWY-7445]]
 +
* [[PWY-6946]]
 +
* [[PWY-5469]]
 +
* [[PWY-6944]]
 +
* [[PWY-5466]]
 +
* [[PWY-6027]]
 +
* [[PWY-361]]
 +
* [[PWY-6948]]
 +
* [[PWY1F-823]]
 +
* [[PWY-6035]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5075}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266578 45266578]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=2656}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57348 57348]
+
{{#set: centisome position=32.68923   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=1.1.1.145-RXN|DIHYDROKAEMPFEROL-4-REDUCTASE-RXN|PEROXID-RXN|RXN-1101|RXN-1106|RXN-1124|RXN-12693|RXN-12747|RXN-12789|RXN-14240|RXN-15288|RXN-17352|RXN-600|RXN-7784|RXN-8635|RXN-9725|RXN66-342|RXN66-350|RXN66-353}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02232 C02232]
+
{{#set: pathway associated=PWY-7299|PWY-7214|PWY-6824|PWY-5152|PWY-5461|PWY66-378|PWY-7445|PWY-6946|PWY-5469|PWY-6944|PWY-5466|PWY-6027|PWY-361|PWY-6948|PWY1F-823|PWY-6035}}
−
* HMDB : HMDB60378
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I}}
+
−
{{#set: common name=3-oxoadipyl-CoA}}
+
−
{{#set: molecular weight=904.605   }}
+
−
{{#set: common name=3-ketoadipyl-CoA|3-keto-adipyl-coa|β-ketoadipyl-CoA}}
+
−
{{#set: consumed or produced by=RXN0-2044}}
+

Latest revision as of 20:24, 21 March 2018

Gene Tiso_gene_11016

  • right end position:
    • 5075
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2656
  • centisome position:
    • 32.68923
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11016&oldid=48486"