Difference between revisions of "CPD-13684"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOKINASE-RXN FRUCTOKINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** hexokinase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOKINASE-RXN FRUCTOKINASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** hexokinase
+
** cholest-5-en-3-one
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.1.4 EC-2.7.1.4]
+
** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
 +
* molecular weight:
 +
** 384.644   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[BETA-D-FRUCTOSE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[FRUCTOSE-6P]][c]
+
* [[RXN-12693]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 β-D-fructofuranose[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 β-D-fructofuranose 6-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3107]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_17974]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_1303]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-5384]], sucrose degradation IV (sucrose phosphorylase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-3801]], sucrose degradation II (sucrose synthase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[SUCUTIL-PWY]], sucrose degradation I (sucrose phosphotransferase): [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[SUCROSEUTIL2-PWY]], sucrose degradation VII (sucrose 3-dehydrogenase): [http://metacyc.org/META/NEW-IMAGE?object=SUCROSEUTIL2-PWY SUCROSEUTIL2-PWY]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-4101]], D-sorbitol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6531]], mannitol cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-621]], sucrose degradation III (sucrose invertase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-621 PWY-621]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
+
−
** '''14''' reactions found over '''18''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
−
*** [[athaliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16125 16125]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00760 R00760]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906]
−
* UNIPROT:
+
* METABOLIGHTS : MTBLC63906
−
** [http://www.uniprot.org/uniprot/Q09124 Q09124]
+
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
** [http://www.uniprot.org/uniprot/P24261 P24261]
+
{{#set: common name=cholest-5-en-3-one}}
−
** [http://www.uniprot.org/uniprot/Q03417 Q03417]
+
{{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}}
−
** [http://www.uniprot.org/uniprot/Q9V0T7 Q9V0T7]
+
{{#set: molecular weight=384.644    }}
−
** [http://www.uniprot.org/uniprot/Q9CFI9 Q9CFI9]
+
{{#set: produced by=RXN-12693}}
−
** [http://www.uniprot.org/uniprot/P22824 P22824]
+
−
** [http://www.uniprot.org/uniprot/P26420 P26420]
+
−
** [http://www.uniprot.org/uniprot/P26984 P26984]
+
−
** [http://www.uniprot.org/uniprot/P37829 P37829]
+
−
** [http://www.uniprot.org/uniprot/P43468 P43468]
+
−
** [http://www.uniprot.org/uniprot/P73521 P73521]
+
−
** [http://www.uniprot.org/uniprot/O82616 O82616]
+
−
** [http://www.uniprot.org/uniprot/O04897 O04897]
+
−
** [http://www.uniprot.org/uniprot/Q42645 Q42645]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=hexokinase}}
+
−
{{#set: ec number=EC-2.7.1.4}}
+
−
{{#set: gene associated=Tiso_gene_3107|Tiso_gene_17974|Tiso_gene_1303}}
+
−
{{#set: in pathway=PWY-5384|PWY-3801|SUCUTIL-PWY|SUCROSEUTIL2-PWY|PWY-4101|PWY-6531|PWY-621|P122-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=creinhardtii|athaliana}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 19:33, 21 March 2018

Metabolite CPD-13684

  • smiles:
    • CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • cholest-5-en-3-one
  • inchi key:
    • InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13684&oldid=42378"