Difference between revisions of "ISOCIT-CLEAV-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISOCIT-CLEAV-RXN ISOCIT-CLEAV-RXN] == * direction: ** REVERSIBLE * common name: ** isocitrate_lyase...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISOCIT-CLEAV-RXN ISOCIT-CLEAV-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** isocitrate_lyase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.1.3.1 EC-4.1.3.1] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[THREO-DS-ISO-CITRATE]][c] '''<=>''' 1 [[GLYOX]][c] '''+''' 1 [[SUC]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 D-threo-isocitrate[c] '''<=>''' 1 glyoxylate[c] '''+''' 1 succinate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14008]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY] | ||
+ | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[GLYOXYLATE-BYPASS]], glyoxylate cycle: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-BYPASS GLYOXYLATE-BYPASS] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969] | ||
+ | ** '''9''' reactions found over '''12''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13245 13245] |
− | * | + | * PIR: |
− | * LIGAND- | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A41338 A41338] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40713 I40713] |
− | * | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JA0155 JA0155] |
− | ** [http://www. | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JC6182 JC6182] |
− | * | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S26857 S26857] |
− | ** [http://www. | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S26858 S26858] |
− | * | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S39953 S39953] |
− | {{#set: | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S52819 S52819] |
− | {{#set: | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S77654 S77654] |
− | {{#set: | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T04115 T04115] |
− | {{#set: | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T06353 T06353] |
− | {{#set: | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07631 T07631] |
− | {{#set: | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07632 T07632] |
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T08046 T08046] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09774 T09774] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09779 T09779] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T11209 T11209] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZBYI WZBYI] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZCKI WZCKI] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZCNIU WZCNIU] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZCSI WZCSI] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZECIC WZECIC] | ||
+ | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=WZRPI WZRPI] | ||
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R00479 R00479] | ||
+ | * UNIPROT: | ||
+ | ** [http://www.uniprot.org/uniprot/P28467 P28467] | ||
+ | ** [http://www.uniprot.org/uniprot/P42449 P42449] | ||
+ | ** [http://www.uniprot.org/uniprot/P20699 P20699] | ||
+ | ** [http://www.uniprot.org/uniprot/O13439 O13439] | ||
+ | ** [http://www.uniprot.org/uniprot/P28299 P28299] | ||
+ | ** [http://www.uniprot.org/uniprot/Q12031 Q12031] | ||
+ | ** [http://www.uniprot.org/uniprot/P46831 P46831] | ||
+ | ** [http://www.uniprot.org/uniprot/O24588 O24588] | ||
+ | ** [http://www.uniprot.org/uniprot/P49297 P49297] | ||
+ | ** [http://www.uniprot.org/uniprot/P45456 P45456] | ||
+ | ** [http://www.uniprot.org/uniprot/P45457 P45457] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39577 Q39577] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41084 Q41084] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43097 Q43097] | ||
+ | ** [http://www.uniprot.org/uniprot/P28240 P28240] | ||
+ | ** [http://www.uniprot.org/uniprot/P20014 P20014] | ||
+ | ** [http://www.uniprot.org/uniprot/P17069 P17069] | ||
+ | ** [http://www.uniprot.org/uniprot/P15479 P15479] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A9G6 P0A9G6] | ||
+ | ** [http://www.uniprot.org/uniprot/P25248 P25248] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=isocitrate_lyase}} | ||
+ | {{#set: ec number=EC-4.1.3.1}} | ||
+ | {{#set: gene associated=Tiso_gene_14008}} | ||
+ | {{#set: in pathway=P105-PWY|GLYOXYLATE-BYPASS|PWY-6969}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 21:04, 21 March 2018
Contents
Reaction ISOCIT-CLEAV-RXN
- direction:
- REVERSIBLE
- common name:
- isocitrate_lyase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 THREO-DS-ISO-CITRATE[c] <=> 1 GLYOX[c] + 1 SUC[c]
- With common name(s):
- 1 D-threo-isocitrate[c] <=> 1 glyoxylate[c] + 1 succinate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14008
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- P105-PWY, TCA cycle IV (2-oxoglutarate decarboxylase): P105-PWY
- 9 reactions found over 11 reactions in the full pathway
- GLYOXYLATE-BYPASS, glyoxylate cycle: GLYOXYLATE-BYPASS
- 6 reactions found over 6 reactions in the full pathway
- PWY-6969, TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): PWY-6969
- 9 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- RHEA:
- PIR:
- LIGAND-RXN:
- UNIPROT: