Difference between revisions of "PWY-5651"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] == * smiles: ** C(C1(=CN=CC=C1))#N * inchi key: ** InChIKey=GZ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5651 PWY-5651] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5651 PWY-5651] ==
* smiles:
+
* taxonomic range:
** C(C1(=CN=CC=C1))#N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 
* common name:
 
* common name:
** 3-cyanopyridine
+
** L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde
* molecular weight:
+
** 104.111   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[R313-RXN]]
+
'''4''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.13.11.6-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_10922]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
* [[3-HYDROXY-KYNURENINASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_10685]]
 +
*** [[Tiso_gene_10684]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[ARYLFORMAMIDASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_16921]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14398]]
 +
*** [[Tiso_gene_6196]]
 +
*** [[Tiso_gene_15790]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8665 RXN-8665]
 
== External links  ==
 
== External links  ==
* CAS : 100-54-9
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=79 79]
+
{{#set: taxonomic range=TAX-33208}}
* CHEMSPIDER:
+
{{#set: common name=L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde}}
** [http://www.chemspider.com/Chemical-Structure.78.html 78]
+
{{#set: reaction found=4}}
* CHEBI:
+
{{#set: total reaction=5}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86556 86556]
+
{{#set: completion rate=80.0}}
* NCI:
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=17558 17558]
+
{{#set: smiles=C(C1(=CN=CC=C1))#N}}
+
{{#set: inchi key=InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N}}
+
{{#set: common name=3-cyanopyridine}}
+
{{#set: molecular weight=104.111    }}
+
{{#set: consumed by=R313-RXN}}
+

Latest revision as of 19:24, 21 March 2018

Pathway PWY-5651

  • taxonomic range:
  • common name:
    • L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde
  • Synonym(s):

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links