Difference between revisions of "PWY-5189"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5189 PWY-5189] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-18...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5189 PWY-5189] ==
* smiles:
+
* taxonomic range:
** C(=O)([O-])CC(=N)C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-1883]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
** InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
** 2-iminosuccinate
+
** tetrapyrrole biosynthesis II (from glycine)
* molecular weight:
+
** 129.072   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-iminobutanedioate
 
** α-iminosuccinate
 
** iminoaspartate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''4''' reactions in the full pathway
* [[L-ASPARTATE-OXID-RXN]]
+
* [[OHMETHYLBILANESYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_11630]]
 +
*** [[Tiso_gene_14709]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PORPHOBILSYNTH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13382]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[UROGENIIISYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_11630]]
 +
*** [[Tiso_gene_18827]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=5-AMINOLEVULINIC-ACID-SYNTHASE-RXN 5-AMINOLEVULINIC-ACID-SYNTHASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1883}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615393 23615393]
+
{{#set: taxonomic range=TAX-33682}}
* HMDB : HMDB01131
+
{{#set: taxonomic range=TAX-33630}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-1224}}
** [http://www.genome.jp/dbget-bin/www_bget?C05840 C05840]
+
{{#set: taxonomic range=TAX-33208}}
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-4751}}
** [http://www.chemspider.com/Chemical-Structure.19951415.html 19951415]
+
{{#set: common name=tetrapyrrole biosynthesis II (from glycine)}}
* CHEBI:
+
{{#set: reaction found=3}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58831 58831]
+
{{#set: total reaction=4}}
* BIGG : iasp
+
{{#set: completion rate=75.0}}
{{#set: smiles=C(=O)([O-])CC(=N)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L}}
+
{{#set: common name=2-iminosuccinate}}
+
{{#set: molecular weight=129.072    }}
+
{{#set: common name=2-iminobutanedioate|α-iminosuccinate|iminoaspartate}}
+
{{#set: produced by=L-ASPARTATE-OXID-RXN}}
+

Latest revision as of 19:38, 21 March 2018

Pathway PWY-5189

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links