Difference between revisions of "PWY-5189"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5189 PWY-5189] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-18...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5189 PWY-5189] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-1883] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | ||
* common name: | * common name: | ||
− | ** | + | ** tetrapyrrole biosynthesis II (from glycine) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''4''' reactions in the full pathway | |
− | * [[ | + | * [[OHMETHYLBILANESYN-RXN]] |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_11630]] | ||
+ | *** [[Tiso_gene_14709]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[PORPHOBILSYNTH-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_13382]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[UROGENIIISYN-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_11630]] | ||
+ | *** [[Tiso_gene_18827]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=5-AMINOLEVULINIC-ACID-SYNTHASE-RXN 5-AMINOLEVULINIC-ACID-SYNTHASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1883}} | |
− | + | {{#set: taxonomic range=TAX-33682}} | |
− | + | {{#set: taxonomic range=TAX-33630}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=tetrapyrrole biosynthesis II (from glycine)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=75.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Pathway PWY-5189
- taxonomic range:
- common name:
- tetrapyrrole biosynthesis II (from glycine)
- Synonym(s):
Reaction(s) found
3 reactions found over 4 reactions in the full pathway
- OHMETHYLBILANESYN-RXN
- 2 associated gene(s):
- 7 reconstruction source(s) associated:
- PORPHOBILSYNTH-RXN
- 1 associated gene(s):
- 7 reconstruction source(s) associated:
- UROGENIIISYN-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated: