Difference between revisions of "RXN-12693"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * common name: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12693 RXN-12693] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-beta_hydroxysteroid_dehyd...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12693 RXN-12693] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
| − | ** | + | ** 3-beta_hydroxysteroid_dehydrogenase_isomerase |
| − | * | + | ** ORF |
| − | * | + | * ec number: |
| − | * | + | ** [http://enzyme.expasy.org/EC/1.1.1.145 EC-1.1.1.145] |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[NAD]][c] '''+''' 1 [[CHOLESTEROL]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-13684]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 NAD+[c] '''+''' 1 cholesterol[c] '''=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 cholest-5-en-3-one[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_11016]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_2957]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_18774]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_897]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6946]], cholesterol degradation to androstenedione II (cholesterol dehydrogenase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6946 PWY-6946] | ||
| + | ** '''3''' reactions found over '''22''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=3-beta_hydroxysteroid_dehydrogenase_isomerase}} | |
| − | + | {{#set: common name=ORF}} | |
| − | + | {{#set: ec number=EC-1.1.1.145}} | |
| − | + | {{#set: gene associated=Tiso_gene_11016|Tiso_gene_2957|Tiso_gene_18774|Tiso_gene_897}} | |
| − | {{#set: | + | {{#set: in pathway=PWY-6946}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
| − | {{#set: | + | |
Latest revision as of 19:50, 21 March 2018
Contents
Reaction RXN-12693
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-beta_hydroxysteroid_dehydrogenase_isomerase
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 CHOLESTEROL[c] => 1 PROTON[c] + 1 NADH[c] + 1 CPD-13684[c]
- With common name(s):
- 1 NAD+[c] + 1 cholesterol[c] => 1 H+[c] + 1 NADH[c] + 1 cholest-5-en-3-one[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11016
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2957
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18774
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_897
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-6946, cholesterol degradation to androstenedione II (cholesterol dehydrogenase): PWY-6946
- 3 reactions found over 22 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
