Difference between revisions of "Tiso gene 15143"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17402 CPD-17402] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
(Created page with "Category:Gene == Gene Tiso_gene_15143 == * right end position: ** 5037 * transcription direction: ** POSITIVE * left end position: ** 3727 * centisome position: ** 71.5767...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17402 CPD-17402] ==
+
== Gene Tiso_gene_15143 ==
−
* smiles:
+
* right end position:
−
** CCC=CCCC(O)CC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5037
−
* common name:
+
* transcription direction:
−
** (3R)-hydroxy-auricoloyl-CoA
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=XTSCLYCOOJHTTR-KTFRUSDTSA-J
+
** 3727
−
* molecular weight:
+
* centisome position:
−
** 1085.989    
+
** 71.57673    
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-hydroxy-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.7.1.127-RXN]]
−
* [[RXN-16154]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6364]]
 +
* [[PWY-6362]]
 +
* [[PWY-6361]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5037}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820222 91820222]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=3727}}
−
{{#set: common name=(3R)-hydroxy-auricoloyl-CoA}}
+
{{#set: centisome position=71.57673   }}
−
{{#set: inchi key=InChIKey=XTSCLYCOOJHTTR-KTFRUSDTSA-J}}
+
{{#set: reaction associated=2.7.1.127-RXN}}
−
{{#set: molecular weight=1085.989   }}
+
{{#set: pathway associated=PWY-6364|PWY-6362|PWY-6361}}
−
{{#set: common name=(3R)-hydroxy-(11Z,17Z)-14R-hydroxy-icosa-11,17-dienoyl-CoA}}
+
−
{{#set: produced by=RXN-16154}}
+

Latest revision as of 20:01, 21 March 2018

Gene Tiso_gene_15143

  • right end position:
    • 5037
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3727
  • centisome position:
    • 71.57673
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15143&oldid=45256"